C15H20N4O4 — CID 111480035
N-(4-hydroxy-2,2-dimethylpentyl)-5-nitro-1H-indazole-3-carboxamide (PubChem CID 111480035) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 111480035 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)-5-nitro-1H-indazole-3-carboxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H20N4O4/c1-9(20)7-15(2,3)8-16-14(21)13-11-6-10(19(22)23)4-5-12(11)17-18-13/h4-6,9,20H,7-8H2,1-3H3,(H,16,21)(H,17,18) |
| InChIKey | AXJLXUKJKOESQL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|