C15H18N4O5 — CID 60582343
methyl 2-methyl-2-[(5-nitro-1H-indazole-3-carbonyl)amino]pentanoate (PubChem CID 60582343) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is methyl 2-methyl-2-[(5-nitro-1H-indazole-3-carbonyl)amino]pentanoate.
| Compound Name | methyl 2-methyl-2-[(5-nitro-1H-indazole-3-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 60582343 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 2-methyl-2-[(5-nitro-1H-indazole-3-carbonyl)amino]pentanoate |
| SMILES | CCCC(C)(NC(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12)C(=O)OC |
| InChI | InChI=1S/C15H18N4O5/c1-4-7-15(2,14(21)24-3)16-13(20)12-10-8-9(19(22)23)5-6-11(10)17-18-12/h5-6,8H,4,7H2,1-3H3,(H,16,20)(H,17,18) |
| InChIKey | PZACXNJTZRRBDN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|