C16H21N3O3 — CID 111480109
N-(4-hydroxy-2,2-dimethylpentyl)-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 111480109) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 111480109 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H21N3O3/c1-10(20)8-16(2,3)9-17-15(22)13-11-6-4-5-7-12(11)14(21)19-18-13/h4-7,10,20H,8-9H2,1-3H3,(H,17,22)(H,19,21) |
| InChIKey | HEYMGMZUBIIVSA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |