C17H22ClN5O3S — CID 119393005
2-(4-nitrophenyl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119393005) has the molecular formula C17H22ClN5O3S and a molecular weight of 411.92 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(4-nitrophenyl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119393005 |
| Molecular Formula | C17H22ClN5O3S |
| Molecular Weight | 411.92 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(4-nitrophenyl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1csc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C17H21N5O3S.ClH/c23-16(19-6-1-9-21-10-7-18-8-11-21)15-12-26-17(20-15)13-2-4-14(5-3-13)22(24)25;/h2-5,12,18H,1,6-11H2,(H,19,23);1H |
| InChIKey | YRRFVRYLYLMVTG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.92 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|