C15H22Cl2N6OS — CID 119392029
N-(3-piperazin-1-ylpropyl)-2-pyrazin-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119392029) has the molecular formula C15H22Cl2N6OS and a molecular weight of 405.36 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-2-pyrazin-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)-2-pyrazin-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119392029 |
| Molecular Formula | C15H22Cl2N6OS |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-2-pyrazin-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCN1CCNCC1)c1csc(-c2cnccn2)n1 |
| InChI | InChI=1S/C15H20N6OS.2ClH/c22-14(19-2-1-7-21-8-5-16-6-9-21)13-11-23-15(20-13)12-10-17-3-4-18-12;;/h3-4,10-11,16H,1-2,5-9H2,(H,19,22);2*1H |
| InChIKey | BSMXWIRSKGXTCI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|