C17H22N4O2S — CID 95293820
N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-2-pyrazin-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 95293820) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-2-pyrazin-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-2-pyrazin-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 95293820 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-2-pyrazin-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)c1csc(-c2cnccn2)n1 |
| InChI | InChI=1S/C17H22N4O2S/c1-12-4-2-3-5-15(12)23-9-8-20-16(22)14-11-24-17(21-14)13-10-18-6-7-19-13/h6-7,10-12,15H,2-5,8-9H2,1H3,(H,20,22)/t12-,15-/m1/s1 |
| InChIKey | MQIDRVWPCVALOC-IUODEOHRSA-N |
| XLogP | 2.93 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|