C16H24N2O2 — CID 51948701
6-methyl-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]pyridine-2-carboxamide (PubChem CID 51948701) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-methyl-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]pyridine-2-carboxamide.
| Compound Name | 6-methyl-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 51948701 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 6-methyl-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]pyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)NCCO[C@@H]2CCCC[C@H]2C)n1 |
| InChI | InChI=1S/C16H24N2O2/c1-12-6-3-4-9-15(12)20-11-10-17-16(19)14-8-5-7-13(2)18-14/h5,7-8,12,15H,3-4,6,9-11H2,1-2H3,(H,17,19)/t12-,15-/m1/s1 |
| InChIKey | UOMKHGUQIKHZDR-IUODEOHRSA-N |
| XLogP | 2.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|