C19H25N3O3 — CID 95904490
N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 95904490) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 95904490 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | Cc1nnc(-c2cccc(C(=O)NCCO[C@@H]3CCCC[C@H]3C)c2)o1 |
| InChI | InChI=1S/C19H25N3O3/c1-13-6-3-4-9-17(13)24-11-10-20-18(23)15-7-5-8-16(12-15)19-22-21-14(2)25-19/h5,7-8,12-13,17H,3-4,6,9-11H2,1-2H3,(H,20,23)/t13-,17-/m1/s1 |
| InChIKey | PWOXLZKPBDCDPQ-CXAGYDPISA-N |
| XLogP | 3.37 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|