C17H17N5O2 — CID 166416546
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 166416546) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 166416546 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | C#CCCC1(CCNC(=O)c2cccc(-c3nnc(C)o3)c2)N=N1 |
| InChI | InChI=1S/C17H17N5O2/c1-3-4-8-17(21-22-17)9-10-18-15(23)13-6-5-7-14(11-13)16-20-19-12(2)24-16/h1,5-7,11H,4,8-10H2,2H3,(H,18,23) |
| InChIKey | NGNCGAZXPWXPOU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|