C19H19N5O2 — CID 166416909
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(3-methoxyphenyl)pyrimidine-2-carboxamide (PubChem CID 166416909) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(3-methoxyphenyl)pyrimidine-2-carboxamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(3-methoxyphenyl)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 166416909 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(3-methoxyphenyl)pyrimidine-2-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)c2ncc(-c3cccc(OC)c3)cn2)N=N1 |
| InChI | InChI=1S/C19H19N5O2/c1-3-4-8-19(23-24-19)9-10-20-18(25)17-21-12-15(13-22-17)14-6-5-7-16(11-14)26-2/h1,5-7,11-13H,4,8-10H2,2H3,(H,20,25) |
| InChIKey | QRIXRVZMOHEMDE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|