C17H17N5O3 — CID 166430099
2-[2-(3-but-3-ynyldiazirin-3-yl)ethylcarbamoyl]-1-methylpyrrolo[2,3-b]pyridine-5-carboxylic acid (PubChem CID 166430099) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-[2-(3-but-3-ynyldiazirin-3-yl)ethylcarbamoyl]-1-methylpyrrolo[2,3-b]pyridine-5-carboxylic acid.
| Compound Name | 2-[2-(3-but-3-ynyldiazirin-3-yl)ethylcarbamoyl]-1-methylpyrrolo[2,3-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 166430099 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[2-(3-but-3-ynyldiazirin-3-yl)ethylcarbamoyl]-1-methylpyrrolo[2,3-b]pyridine-5-carboxylic acid |
| SMILES | C#CCCC1(CCNC(=O)c2cc3cc(C(=O)O)cnc3n2C)N=N1 |
| InChI | InChI=1S/C17H17N5O3/c1-3-4-5-17(20-21-17)6-7-18-15(23)13-9-11-8-12(16(24)25)10-19-14(11)22(13)2/h1,8-10H,4-7H2,2H3,(H,18,23)(H,24,25) |
| InChIKey | ZYRTYSYOJZOODS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|