C18H20F2N4O2 — CID 166416664
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,5-difluoro-4-morpholin-4-ylbenzamide (PubChem CID 166416664) has the molecular formula C18H20F2N4O2 and a molecular weight of 362.38 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,5-difluoro-4-morpholin-4-ylbenzamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,5-difluoro-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 166416664 |
| Molecular Formula | C18H20F2N4O2 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,5-difluoro-4-morpholin-4-ylbenzamide |
| SMILES | C#CCCC1(CCNC(=O)c2cc(F)c(N3CCOCC3)c(F)c2)N=N1 |
| InChI | InChI=1S/C18H20F2N4O2/c1-2-3-4-18(22-23-18)5-6-21-17(25)13-11-14(19)16(15(20)12-13)24-7-9-26-10-8-24/h1,11-12H,3-10H2,(H,21,25) |
| InChIKey | KIMJVVPBNVWXHX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|