C17H17F3N4O2 — CID 167765934
3-acetamido-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 167765934) has the molecular formula C17H17F3N4O2 and a molecular weight of 366.34 g/mol. Its IUPAC name is 3-acetamido-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-acetamido-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 167765934 |
| Molecular Formula | C17H17F3N4O2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3-acetamido-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | C#CCCC1(CCNC(=O)c2cc(NC(C)=O)cc(C(F)(F)F)c2)N=N1 |
| InChI | InChI=1S/C17H17F3N4O2/c1-3-4-5-16(23-24-16)6-7-21-15(26)12-8-13(17(18,19)20)10-14(9-12)22-11(2)25/h1,8-10H,4-7H2,2H3,(H,21,26)(H,22,25) |
| InChIKey | LHHINPCZYQJNAF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|