C15H17F3N2O4 — CID 120535032
4-[[3-acetamido-5-(trifluoromethyl)benzoyl]amino]pentanoic acid (PubChem CID 120535032) has the molecular formula C15H17F3N2O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is 4-[[3-acetamido-5-(trifluoromethyl)benzoyl]amino]pentanoic acid.
| Compound Name | 4-[[3-acetamido-5-(trifluoromethyl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120535032 |
| Molecular Formula | C15H17F3N2O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-[[3-acetamido-5-(trifluoromethyl)benzoyl]amino]pentanoic acid |
| SMILES | CC(=O)Nc1cc(C(=O)NC(C)CCC(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O4/c1-8(3-4-13(22)23)19-14(24)10-5-11(15(16,17)18)7-12(6-10)20-9(2)21/h5-8H,3-4H2,1-2H3,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | LSQQMXUAVPWZIC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |