C15H21F4NO — CID 162064632
3-fluoro-N-[(2R)-4-methylpentan-2-yl]-5-(trifluoromethyl)benzamide;methane (PubChem CID 162064632) has the molecular formula C15H21F4NO and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-fluoro-N-[(2R)-4-methylpentan-2-yl]-5-(trifluoromethyl)benzamide;methane.
| Compound Name | 3-fluoro-N-[(2R)-4-methylpentan-2-yl]-5-(trifluoromethyl)benzamide;methane |
|---|---|
| PubChem CID | 162064632 |
| Molecular Formula | C15H21F4NO |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 3-fluoro-N-[(2R)-4-methylpentan-2-yl]-5-(trifluoromethyl)benzamide;methane |
| SMILES | C.CC(C)C[C@@H](C)NC(=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F4NO.CH4/c1-8(2)4-9(3)19-13(20)10-5-11(14(16,17)18)7-12(15)6-10;/h5-9H,4H2,1-3H3,(H,19,20);1H4/t9-;/m1./s1 |
| InChIKey | ZAHHINHGIAOXSY-SBSPUUFOSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |