C12H14F4N2O — CID 119509675
N-[2-(ethylamino)ethyl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 119509675) has the molecular formula C12H14F4N2O and a molecular weight of 278.25 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(ethylamino)ethyl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119509675 |
| Molecular Formula | C12H14F4N2O |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | CCNCCNC(=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F4N2O/c1-2-17-3-4-18-11(19)8-5-9(12(14,15)16)7-10(13)6-8/h5-7,17H,2-4H2,1H3,(H,18,19) |
| InChIKey | QOKBDNYMPFNXMN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|