C15H18F4N2O — CID 134422953
3-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-5-(trifluoromethyl)benzamide (PubChem CID 134422953) has the molecular formula C15H18F4N2O and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 134422953 |
| Molecular Formula | C15H18F4N2O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-5-(trifluoromethyl)benzamide |
| SMILES | CN1CCC(CNC(=O)c2cc(F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H18F4N2O/c1-21-4-2-10(3-5-21)9-20-14(22)11-6-12(15(17,18)19)8-13(16)7-11/h6-8,10H,2-5,9H2,1H3,(H,20,22) |
| InChIKey | IOXMESYKHKKQAS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |