C14H16F4N2O — CID 99849672
3-fluoro-N-[[(3R)-piperidin-3-yl]methyl]-5-(trifluoromethyl)benzamide (PubChem CID 99849672) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is 3-fluoro-N-[[(3R)-piperidin-3-yl]methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-fluoro-N-[[(3R)-piperidin-3-yl]methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 99849672 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-fluoro-N-[[(3R)-piperidin-3-yl]methyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NC[C@@H]1CCCNC1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F4N2O/c15-12-5-10(4-11(6-12)14(16,17)18)13(21)20-8-9-2-1-3-19-7-9/h4-6,9,19H,1-3,7-8H2,(H,20,21)/t9-/m1/s1 |
| InChIKey | VHDVWBKCYAEODQ-SECBINFHSA-N |
| XLogP | 2.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |