C15H16F6N2O — CID 119461836
N-(piperidin-3-ylmethyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 119461836) has the molecular formula C15H16F6N2O and a molecular weight of 354.29 g/mol. Its IUPAC name is N-(piperidin-3-ylmethyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(piperidin-3-ylmethyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119461836 |
| Molecular Formula | C15H16F6N2O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-(piperidin-3-ylmethyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1CCCNC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F6N2O/c16-14(17,18)11-4-10(5-12(6-11)15(19,20)21)13(24)23-8-9-2-1-3-22-7-9/h4-6,9,22H,1-3,7-8H2,(H,23,24) |
| InChIKey | HGQHBFCDAZJFCN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |