C15H18F3IN2O — CID 86886749
3-iodo-N-[(1-methylpiperidin-4-yl)methyl]-5-(trifluoromethyl)benzamide (PubChem CID 86886749) has the molecular formula C15H18F3IN2O and a molecular weight of 426.22 g/mol. Its IUPAC name is 3-iodo-N-[(1-methylpiperidin-4-yl)methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-iodo-N-[(1-methylpiperidin-4-yl)methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 86886749 |
| Molecular Formula | C15H18F3IN2O |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 3-iodo-N-[(1-methylpiperidin-4-yl)methyl]-5-(trifluoromethyl)benzamide |
| SMILES | CN1CCC(CNC(=O)c2cc(I)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H18F3IN2O/c1-21-4-2-10(3-5-21)9-20-14(22)11-6-12(15(16,17)18)8-13(19)7-11/h6-8,10H,2-5,9H2,1H3,(H,20,22) |
| InChIKey | AXJRLFUMPDWSGH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|