C21H29F3IN3O2 — CID 89410604
N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-(iodomethyl)-5-(trifluoromethyl)benzamide (PubChem CID 89410604) has the molecular formula C21H29F3IN3O2 and a molecular weight of 539.38 g/mol. Its IUPAC name is N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-(iodomethyl)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-(iodomethyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 89410604 |
| Molecular Formula | C21H29F3IN3O2 |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-(iodomethyl)-5-(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)NC(=O)CN1CCC(CNC(=O)c2cc(CI)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H29F3IN3O2/c1-20(2,3)27-18(29)13-28-6-4-14(5-7-28)12-26-19(30)16-8-15(11-25)9-17(10-16)21(22,23)24/h8-10,14H,4-7,11-13H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | VVFWEDNWFIAWAB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|