C25H35Cl2N3O2 — CID 146617337
N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-[(2E,4E)-3,5-dichlorohexa-2,4-dienyl]benzamide (PubChem CID 146617337) has the molecular formula C25H35Cl2N3O2 and a molecular weight of 480.48 g/mol. Its IUPAC name is N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-[(2E,4E)-3,5-dichlorohexa-2,4-dienyl]benzamide.
| Compound Name | N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-[(2E,4E)-3,5-dichlorohexa-2,4-dienyl]benzamide |
|---|---|
| PubChem CID | 146617337 |
| Molecular Formula | C25H35Cl2N3O2 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3-[(2E,4E)-3,5-dichlorohexa-2,4-dienyl]benzamide |
| SMILES | C/C(Cl)=C\C(Cl)=C/Cc1cccc(C(=O)NCC2CCN(CC(=O)NC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C25H35Cl2N3O2/c1-18(26)14-22(27)9-8-19-6-5-7-21(15-19)24(32)28-16-20-10-12-30(13-11-20)17-23(31)29-25(2,3)4/h5-7,9,14-15,20H,8,10-13,16-17H2,1-4H3,(H,28,32)(H,29,31)/b18-14+,22-9+ |
| InChIKey | VVSNWTWMLVABOI-ARAODSLZSA-N |
| XLogP | 4.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|