C10H10F3IN2O — CID 119384158
N-(2-aminoethyl)-3-iodo-5-(trifluoromethyl)benzamide (PubChem CID 119384158) has the molecular formula C10H10F3IN2O and a molecular weight of 358.10 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-iodo-5-(trifluoromethyl)benzamide.
| Compound Name | N-(2-aminoethyl)-3-iodo-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119384158 |
| Molecular Formula | C10H10F3IN2O |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | N-(2-aminoethyl)-3-iodo-5-(trifluoromethyl)benzamide |
| SMILES | NCCNC(=O)c1cc(I)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3IN2O/c11-10(12,13)7-3-6(4-8(14)5-7)9(17)16-2-1-15/h3-5H,1-2,15H2,(H,16,17) |
| InChIKey | GLTZAPDTBJEGLC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|