C13H15ClF3IN2O — CID 119388602
3-iodo-N-piperidin-4-yl-5-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 119388602) has the molecular formula C13H15ClF3IN2O and a molecular weight of 434.63 g/mol. Its IUPAC name is 3-iodo-N-piperidin-4-yl-5-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | 3-iodo-N-piperidin-4-yl-5-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119388602 |
| Molecular Formula | C13H15ClF3IN2O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 3-iodo-N-piperidin-4-yl-5-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCNCC1)c1cc(I)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3IN2O.ClH/c14-13(15,16)9-5-8(6-10(17)7-9)12(20)19-11-1-3-18-4-2-11;/h5-7,11,18H,1-4H2,(H,19,20);1H |
| InChIKey | IQAXBGLKXIKLJN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|