C18H24ClF3N2O — CID 171361785
N-cyclopentyl-3-piperidin-4-yl-4-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 171361785) has the molecular formula C18H24ClF3N2O and a molecular weight of 376.85 g/mol. Its IUPAC name is N-cyclopentyl-3-piperidin-4-yl-4-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-cyclopentyl-3-piperidin-4-yl-4-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 171361785 |
| Molecular Formula | C18H24ClF3N2O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-cyclopentyl-3-piperidin-4-yl-4-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCC1)c1ccc(C(F)(F)F)c(C2CCNCC2)c1 |
| InChI | InChI=1S/C18H23F3N2O.ClH/c19-18(20,21)16-6-5-13(17(24)23-14-3-1-2-4-14)11-15(16)12-7-9-22-10-8-12;/h5-6,11-12,14,22H,1-4,7-10H2,(H,23,24);1H |
| InChIKey | NLGFDAKPTIWWLS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |