C16H22F3NO — CID 143518769
N-cyclopentyl-4-methyl-3-(trifluoromethyl)benzamide;ethane (PubChem CID 143518769) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is N-cyclopentyl-4-methyl-3-(trifluoromethyl)benzamide;ethane.
| Compound Name | N-cyclopentyl-4-methyl-3-(trifluoromethyl)benzamide;ethane |
|---|---|
| PubChem CID | 143518769 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-cyclopentyl-4-methyl-3-(trifluoromethyl)benzamide;ethane |
| SMILES | CC.Cc1ccc(C(=O)NC2CCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO.C2H6/c1-9-6-7-10(8-12(9)14(15,16)17)13(19)18-11-4-2-3-5-11;1-2/h6-8,11H,2-5H2,1H3,(H,18,19);1-2H3 |
| InChIKey | NXOPGFRICSIOLT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |