C14H14Br2F3NO — CID 114309058
4-bromo-N-(4-bromocyclohexyl)-3-(trifluoromethyl)benzamide (PubChem CID 114309058) has the molecular formula C14H14Br2F3NO and a molecular weight of 429.07 g/mol. Its IUPAC name is 4-bromo-N-(4-bromocyclohexyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(4-bromocyclohexyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 114309058 |
| Molecular Formula | C14H14Br2F3NO |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 4-bromo-N-(4-bromocyclohexyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCC(Br)CC1)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14Br2F3NO/c15-9-2-4-10(5-3-9)20-13(21)8-1-6-12(16)11(7-8)14(17,18)19/h1,6-7,9-10H,2-5H2,(H,20,21) |
| InChIKey | CKZRZKXTXTWBHK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|