C14H13BrF5NO — CID 176508179
3-bromo-N-(4,4-difluorocyclohexyl)-4-(trifluoromethyl)benzamide (PubChem CID 176508179) has the molecular formula C14H13BrF5NO and a molecular weight of 386.16 g/mol. Its IUPAC name is 3-bromo-N-(4,4-difluorocyclohexyl)-4-(trifluoromethyl)benzamide.
| Compound Name | 3-bromo-N-(4,4-difluorocyclohexyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 176508179 |
| Molecular Formula | C14H13BrF5NO |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 3-bromo-N-(4,4-difluorocyclohexyl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCC(F)(F)CC1)c1ccc(C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C14H13BrF5NO/c15-11-7-8(1-2-10(11)14(18,19)20)12(22)21-9-3-5-13(16,17)6-4-9/h1-2,7,9H,3-6H2,(H,21,22) |
| InChIKey | VGKBEZUYZMWNQH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |