C16H15BrF4NO4PS — CID 175683061
[[3-bromo-5-[(4,4-difluorocyclohexyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid (PubChem CID 175683061) has the molecular formula C16H15BrF4NO4PS and a molecular weight of 504.24 g/mol. Its IUPAC name is [[3-bromo-5-[(4,4-difluorocyclohexyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[3-bromo-5-[(4,4-difluorocyclohexyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 175683061 |
| Molecular Formula | C16H15BrF4NO4PS |
| Molecular Weight | 504.24 g/mol |
| Exact Mass | 502.96 |
| IUPAC Name | [[3-bromo-5-[(4,4-difluorocyclohexyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(NC1CCC(F)(F)CC1)c1ccc2sc(C(F)(F)P(=O)(O)O)c(Br)c2c1 |
| InChI | InChI=1S/C16H15BrF4NO4PS/c17-12-10-7-8(14(23)22-9-3-5-15(18,19)6-4-9)1-2-11(10)28-13(12)16(20,21)27(24,25)26/h1-2,7,9H,3-6H2,(H,22,23)(H2,24,25,26) |
| InChIKey | URIJJSSQNMSQEI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|