C22H30F2N2OS — CID 175935237
N-(4,4-difluorocyclohexyl)-2-octan-3-yl-1,3-benzothiazole-6-carboxamide (PubChem CID 175935237) has the molecular formula C22H30F2N2OS and a molecular weight of 408.56 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-octan-3-yl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-octan-3-yl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 175935237 |
| Molecular Formula | C22H30F2N2OS |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-octan-3-yl-1,3-benzothiazole-6-carboxamide |
| SMILES | CCCCCC(CC)c1nc2ccc(C(=O)NC3CCC(F)(F)CC3)cc2s1 |
| InChI | InChI=1S/C22H30F2N2OS/c1-3-5-6-7-15(4-2)21-26-18-9-8-16(14-19(18)28-21)20(27)25-17-10-12-22(23,24)13-11-17/h8-9,14-15,17H,3-7,10-13H2,1-2H3,(H,25,27) |
| InChIKey | WBULMZHQNWNIIK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|