2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid

C17H15NO2S — CID 107470279

IUPAC2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid
SMILESCCC(c1ccccc1)c1nc2ccc(C(=O)O)cc2s1
InChIInChI=1S/C17H15NO2S/c1-2-13(11-6-4-3-5-7-11)16-18-14-9-8-12(17(19)20)10-15(14)21-16/h3-10,13H,2H2,1H3,(H,19,20)
InChIKeyDAONCYSFEJPYIN-UHFFFAOYSA-N
MW297.38 g/mol
LogP4.54
Rot. Bonds4

About 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid

2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 107470279) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid.

Molecular Properties

Compound Name2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid
PubChem CID107470279
Molecular FormulaC17H15NO2S
Molecular Weight297.38 g/mol
Exact Mass297.08
IUPAC Name2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid
SMILESCCC(c1ccccc1)c1nc2ccc(C(=O)O)cc2s1
InChIInChI=1S/C17H15NO2S/c1-2-13(11-6-4-3-5-7-11)16-18-14-9-8-12(17(19)20)10-15(14)21-16/h3-10,13H,2H2,1H3,(H,19,20)
InChIKeyDAONCYSFEJPYIN-UHFFFAOYSA-N
XLogP4.54
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.38
LogP ≤ 54.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid?
The IUPAC name of 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid (CID 107470279) is 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid.
What is the SMILES notation for 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid?
The canonical SMILES for 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid is CCC(c1ccccc1)c1nc2ccc(C(=O)O)cc2s1.
What is the InChIKey of 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid?
The InChIKey is DAONCYSFEJPYIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2S/c1-2-13(11-6-4-3-5-7-11)16-18-14-9-8-12(17(19)20)10-15(14)21-16/h3-10,13H,2H2,1H3,(H,19,20).
What are the key properties of 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid?
2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid has a molecular weight of 297.38 g/mol, XLogP of 4.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenylpropyl)-1,3-benzothiazole-6-carboxylic acid is sourced from PubChem (CID 107470279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).