2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid

C11H12N2O2S — CID 82389190

IUPAC2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid
SMILESCCC(N)c1nc2cc(C(=O)O)ccc2s1
InChIInChI=1S/C11H12N2O2S/c1-2-7(12)10-13-8-5-6(11(14)15)3-4-9(8)16-10/h3-5,7H,2,12H2,1H3,(H,14,15)
InChIKeyOCZFRMLJEARHQD-UHFFFAOYSA-N
MW236.30 g/mol
LogP2.40
Rot. Bonds3

About 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid

2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid (PubChem CID 82389190) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid
PubChem CID82389190
Molecular FormulaC11H12N2O2S
Molecular Weight236.30 g/mol
Exact Mass236.06
IUPAC Name2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid
SMILESCCC(N)c1nc2cc(C(=O)O)ccc2s1
InChIInChI=1S/C11H12N2O2S/c1-2-7(12)10-13-8-5-6(11(14)15)3-4-9(8)16-10/h3-5,7H,2,12H2,1H3,(H,14,15)
InChIKeyOCZFRMLJEARHQD-UHFFFAOYSA-N
XLogP2.40
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.30
LogP ≤ 52.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid?
The IUPAC name of 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid (CID 82389190) is 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid.
What is the SMILES notation for 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid?
The canonical SMILES for 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid is CCC(N)c1nc2cc(C(=O)O)ccc2s1.
What is the InChIKey of 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid?
The InChIKey is OCZFRMLJEARHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-2-7(12)10-13-8-5-6(11(14)15)3-4-9(8)16-10/h3-5,7H,2,12H2,1H3,(H,14,15).
What are the key properties of 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid?
2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid has a molecular weight of 236.30 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminopropyl)-1,3-benzothiazole-5-carboxylic acid is sourced from PubChem (CID 82389190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).