C13H16N2O2S — CID 117415560
3-amino-2-(2-propan-2-yl-1,3-benzothiazol-5-yl)propanoic acid (PubChem CID 117415560) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-amino-2-(2-propan-2-yl-1,3-benzothiazol-5-yl)propanoic acid.
| Compound Name | 3-amino-2-(2-propan-2-yl-1,3-benzothiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 117415560 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-amino-2-(2-propan-2-yl-1,3-benzothiazol-5-yl)propanoic acid |
| SMILES | CC(C)c1nc2cc(C(CN)C(=O)O)ccc2s1 |
| InChI | InChI=1S/C13H16N2O2S/c1-7(2)12-15-10-5-8(3-4-11(10)18-12)9(6-14)13(16)17/h3-5,7,9H,6,14H2,1-2H3,(H,16,17) |
| InChIKey | JJCLRNHXRMMCBI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |