C17H15NO2S — CID 125494301
(2R)-2-[2-(4-methylphenyl)-1,3-benzothiazol-5-yl]propanoic acid (PubChem CID 125494301) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is (2R)-2-[2-(4-methylphenyl)-1,3-benzothiazol-5-yl]propanoic acid.
| Compound Name | (2R)-2-[2-(4-methylphenyl)-1,3-benzothiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 125494301 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2R)-2-[2-(4-methylphenyl)-1,3-benzothiazol-5-yl]propanoic acid |
| SMILES | Cc1ccc(-c2nc3cc([C@@H](C)C(=O)O)ccc3s2)cc1 |
| InChI | InChI=1S/C17H15NO2S/c1-10-3-5-12(6-4-10)16-18-14-9-13(11(2)17(19)20)7-8-15(14)21-16/h3-9,11H,1-2H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | UKDQKUNUJXXJMW-LLVKDONJSA-N |
| XLogP | 4.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |