C15H9NO4S — CID 142416097
2-(4-carboxyphenyl)-1,3-benzothiazole-5-carboxylic acid (PubChem CID 142416097) has the molecular formula C15H9NO4S and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-(4-carboxyphenyl)-1,3-benzothiazole-5-carboxylic acid.
| Compound Name | 2-(4-carboxyphenyl)-1,3-benzothiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 142416097 |
| Molecular Formula | C15H9NO4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-(4-carboxyphenyl)-1,3-benzothiazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2nc3cc(C(=O)O)ccc3s2)cc1 |
| InChI | InChI=1S/C15H9NO4S/c17-14(18)9-3-1-8(2-4-9)13-16-11-7-10(15(19)20)5-6-12(11)21-13/h1-7H,(H,17,18)(H,19,20) |
| InChIKey | ONNJRJFYPMFRJG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |