C10H7NO3S2 — CID 19772402
2-(2-oxo-2-sulfanylethyl)-1,3-benzothiazole-5-carboxylic acid (PubChem CID 19772402) has the molecular formula C10H7NO3S2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2-oxo-2-sulfanylethyl)-1,3-benzothiazole-5-carboxylic acid.
| Compound Name | 2-(2-oxo-2-sulfanylethyl)-1,3-benzothiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19772402 |
| Molecular Formula | C10H7NO3S2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 2-(2-oxo-2-sulfanylethyl)-1,3-benzothiazole-5-carboxylic acid |
| SMILES | O=C(S)Cc1nc2cc(C(=O)O)ccc2s1 |
| InChI | InChI=1S/C10H7NO3S2/c12-9(15)4-8-11-6-3-5(10(13)14)1-2-7(6)16-8/h1-3H,4H2,(H,12,15)(H,13,14) |
| InChIKey | LAZUHUUYHRJJRX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|