C24H19NO3S — CID 58470165
3-[3-oxo-4-(5-phenyl-1,3-benzothiazol-2-yl)butyl]benzoic acid (PubChem CID 58470165) has the molecular formula C24H19NO3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[3-oxo-4-(5-phenyl-1,3-benzothiazol-2-yl)butyl]benzoic acid.
| Compound Name | 3-[3-oxo-4-(5-phenyl-1,3-benzothiazol-2-yl)butyl]benzoic acid |
|---|---|
| PubChem CID | 58470165 |
| Molecular Formula | C24H19NO3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-[3-oxo-4-(5-phenyl-1,3-benzothiazol-2-yl)butyl]benzoic acid |
| SMILES | O=C(CCc1cccc(C(=O)O)c1)Cc1nc2cc(-c3ccccc3)ccc2s1 |
| InChI | InChI=1S/C24H19NO3S/c26-20(11-9-16-5-4-8-19(13-16)24(27)28)15-23-25-21-14-18(10-12-22(21)29-23)17-6-2-1-3-7-17/h1-8,10,12-14H,9,11,15H2,(H,27,28) |
| InChIKey | FAZAMNLOEXALBI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |