C14H6F3NO2S — CID 107470249
2-(3,4,5-trifluorophenyl)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 107470249) has the molecular formula C14H6F3NO2S and a molecular weight of 309.27 g/mol. Its IUPAC name is 2-(3,4,5-trifluorophenyl)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-(3,4,5-trifluorophenyl)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 107470249 |
| Molecular Formula | C14H6F3NO2S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 2-(3,4,5-trifluorophenyl)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-c3cc(F)c(F)c(F)c3)sc2c1 |
| InChI | InChI=1S/C14H6F3NO2S/c15-8-3-7(4-9(16)12(8)17)13-18-10-2-1-6(14(19)20)5-11(10)21-13/h1-5H,(H,19,20) |
| InChIKey | RFOPSEYSNOLMSY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|