2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid

C14H7F2NO2S — CID 107470349

IUPAC2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(-c3c(F)cccc3F)sc2c1
InChIInChI=1S/C14H7F2NO2S/c15-8-2-1-3-9(16)12(8)13-17-10-5-4-7(14(18)19)6-11(10)20-13/h1-6H,(H,18,19)
InChIKeyHQCFGPOKHNQKMW-UHFFFAOYSA-N
MW291.28 g/mol
LogP3.94
Rot. Bonds2

About 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid

2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 107470349) has the molecular formula C14H7F2NO2S and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid.

Molecular Properties

Compound Name2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid
PubChem CID107470349
Molecular FormulaC14H7F2NO2S
Molecular Weight291.28 g/mol
Exact Mass291.02
IUPAC Name2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(-c3c(F)cccc3F)sc2c1
InChIInChI=1S/C14H7F2NO2S/c15-8-2-1-3-9(16)12(8)13-17-10-5-4-7(14(18)19)6-11(10)20-13/h1-6H,(H,18,19)
InChIKeyHQCFGPOKHNQKMW-UHFFFAOYSA-N
XLogP3.94
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.28
LogP ≤ 53.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid?
The IUPAC name of 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid (CID 107470349) is 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid.
What is the SMILES notation for 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid?
The canonical SMILES for 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid is O=C(O)c1ccc2nc(-c3c(F)cccc3F)sc2c1.
What is the InChIKey of 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid?
The InChIKey is HQCFGPOKHNQKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7F2NO2S/c15-8-2-1-3-9(16)12(8)13-17-10-5-4-7(14(18)19)6-11(10)20-13/h1-6H,(H,18,19).
What are the key properties of 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid?
2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid has a molecular weight of 291.28 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-1,3-benzothiazole-6-carboxylic acid is sourced from PubChem (CID 107470349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).