C15H10FNO3S — CID 107470295
2-(2-fluoro-6-methoxyphenyl)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 107470295) has the molecular formula C15H10FNO3S and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-(2-fluoro-6-methoxyphenyl)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-(2-fluoro-6-methoxyphenyl)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 107470295 |
| Molecular Formula | C15H10FNO3S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-(2-fluoro-6-methoxyphenyl)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | COc1cccc(F)c1-c1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C15H10FNO3S/c1-20-11-4-2-3-9(16)13(11)14-17-10-6-5-8(15(18)19)7-12(10)21-14/h2-7H,1H3,(H,18,19) |
| InChIKey | XXALYYVBNIQYGH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |