C15H12ClNOS — CID 134862335
6-chloro-2-(2-methoxy-6-methylphenyl)-1,3-benzothiazole (PubChem CID 134862335) has the molecular formula C15H12ClNOS and a molecular weight of 289.79 g/mol. Its IUPAC name is 6-chloro-2-(2-methoxy-6-methylphenyl)-1,3-benzothiazole.
| Compound Name | 6-chloro-2-(2-methoxy-6-methylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 134862335 |
| Molecular Formula | C15H12ClNOS |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 6-chloro-2-(2-methoxy-6-methylphenyl)-1,3-benzothiazole |
| SMILES | COc1cccc(C)c1-c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C15H12ClNOS/c1-9-4-3-5-12(18-2)14(9)15-17-11-7-6-10(16)8-13(11)19-15/h3-8H,1-2H3 |
| InChIKey | XJTLXMXLNZZNHI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |