C13H6ClF2NS — CID 102236316
2-(2-chloro-6-fluorophenyl)-6-fluoro-1,3-benzothiazole (PubChem CID 102236316) has the molecular formula C13H6ClF2NS and a molecular weight of 281.71 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-6-fluoro-1,3-benzothiazole.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-6-fluoro-1,3-benzothiazole |
|---|---|
| PubChem CID | 102236316 |
| Molecular Formula | C13H6ClF2NS |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-6-fluoro-1,3-benzothiazole |
| SMILES | Fc1ccc2nc(-c3c(F)cccc3Cl)sc2c1 |
| InChI | InChI=1S/C13H6ClF2NS/c14-8-2-1-3-9(16)12(8)13-17-10-5-4-7(15)6-11(10)18-13/h1-6H |
| InChIKey | PDTRXWHFSMFRPI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |