C15H9ClN2S — CID 155931557
3-chloro-2-(6-methyl-1,3-benzothiazol-2-yl)benzonitrile (PubChem CID 155931557) has the molecular formula C15H9ClN2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-chloro-2-(6-methyl-1,3-benzothiazol-2-yl)benzonitrile.
| Compound Name | 3-chloro-2-(6-methyl-1,3-benzothiazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 155931557 |
| Molecular Formula | C15H9ClN2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3-chloro-2-(6-methyl-1,3-benzothiazol-2-yl)benzonitrile |
| SMILES | Cc1ccc2nc(-c3c(Cl)cccc3C#N)sc2c1 |
| InChI | InChI=1S/C15H9ClN2S/c1-9-5-6-12-13(7-9)19-15(18-12)14-10(8-17)3-2-4-11(14)16/h2-7H,1H3 |
| InChIKey | KSFJECMRUIZFES-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |