C8H6ClNS — CID 2049866
2-chloro-6-methyl-1,3-benzothiazole (PubChem CID 2049866) has the molecular formula C8H6ClNS and a molecular weight of 183.66 g/mol. Its IUPAC name is 2-chloro-6-methyl-1,3-benzothiazole.
| Compound Name | 2-chloro-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 2049866 |
| Molecular Formula | C8H6ClNS |
| Molecular Weight | 183.66 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 2-chloro-6-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C8H6ClNS/c1-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3 |
| InChIKey | PAKSGYIFUVNJQF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |