C7H4ClNS2 — CID 70528967
2-chloro-1,3-benzothiazole-6-thiol (PubChem CID 70528967) has the molecular formula C7H4ClNS2 and a molecular weight of 201.70 g/mol. Its IUPAC name is 2-chloro-1,3-benzothiazole-6-thiol.
| Compound Name | 2-chloro-1,3-benzothiazole-6-thiol |
|---|---|
| PubChem CID | 70528967 |
| Molecular Formula | C7H4ClNS2 |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 200.95 |
| IUPAC Name | 2-chloro-1,3-benzothiazole-6-thiol |
| SMILES | Sc1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C7H4ClNS2/c8-7-9-5-2-1-4(10)3-6(5)11-7/h1-3,10H |
| InChIKey | STNWFUXHJJRXPY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|