C7H3ClNO2S2- — CID 118579972
2-chloro-1,3-benzothiazole-6-sulfinate (PubChem CID 118579972) has the molecular formula C7H3ClNO2S2- and a molecular weight of 232.69 g/mol. Its IUPAC name is 2-chloro-1,3-benzothiazole-6-sulfinate.
| Compound Name | 2-chloro-1,3-benzothiazole-6-sulfinate |
|---|---|
| PubChem CID | 118579972 |
| Molecular Formula | C7H3ClNO2S2- |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 231.93 |
| IUPAC Name | 2-chloro-1,3-benzothiazole-6-sulfinate |
| SMILES | O=S([O-])c1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C7H4ClNO2S2/c8-7-9-5-2-1-4(13(10)11)3-6(5)12-7/h1-3H,(H,10,11)/p-1 |
| InChIKey | YZIUACDNBNMDQM-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|