acetic acid;2-chloro-1,3-benzothiazol-6-ol

C9H8ClNO3S — CID 70388805

IUPACacetic acid;2-chloro-1,3-benzothiazol-6-ol
SMILESCC(=O)O.Oc1ccc2nc(Cl)sc2c1
InChIInChI=1S/C7H4ClNOS.C2H4O2/c8-7-9-5-2-1-4(10)3-6(5)11-7;1-2(3)4/h1-3,10H;1H3,(H,3,4)
InChIKeyHDPFVMHPYKDMJW-UHFFFAOYSA-N
MW245.69 g/mol
LogP2.75
Rot. Bonds

About acetic acid;2-chloro-1,3-benzothiazol-6-ol

acetic acid;2-chloro-1,3-benzothiazol-6-ol (PubChem CID 70388805) has the molecular formula C9H8ClNO3S and a molecular weight of 245.69 g/mol. Its IUPAC name is acetic acid;2-chloro-1,3-benzothiazol-6-ol.

Molecular Properties

Compound Nameacetic acid;2-chloro-1,3-benzothiazol-6-ol
PubChem CID70388805
Molecular FormulaC9H8ClNO3S
Molecular Weight245.69 g/mol
Exact Mass244.99
IUPAC Nameacetic acid;2-chloro-1,3-benzothiazol-6-ol
SMILESCC(=O)O.Oc1ccc2nc(Cl)sc2c1
InChIInChI=1S/C7H4ClNOS.C2H4O2/c8-7-9-5-2-1-4(10)3-6(5)11-7;1-2(3)4/h1-3,10H;1H3,(H,3,4)
InChIKeyHDPFVMHPYKDMJW-UHFFFAOYSA-N
XLogP2.75
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.69
LogP ≤ 52.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze acetic acid;2-chloro-1,3-benzothiazol-6-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-chloro-1,3-benzothiazol-6-ol?
The IUPAC name of acetic acid;2-chloro-1,3-benzothiazol-6-ol (CID 70388805) is acetic acid;2-chloro-1,3-benzothiazol-6-ol.
What is the SMILES notation for acetic acid;2-chloro-1,3-benzothiazol-6-ol?
The canonical SMILES for acetic acid;2-chloro-1,3-benzothiazol-6-ol is CC(=O)O.Oc1ccc2nc(Cl)sc2c1.
What is the InChIKey of acetic acid;2-chloro-1,3-benzothiazol-6-ol?
The InChIKey is HDPFVMHPYKDMJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNOS.C2H4O2/c8-7-9-5-2-1-4(10)3-6(5)11-7;1-2(3)4/h1-3,10H;1H3,(H,3,4).
What are the key properties of acetic acid;2-chloro-1,3-benzothiazol-6-ol?
acetic acid;2-chloro-1,3-benzothiazol-6-ol has a molecular weight of 245.69 g/mol, XLogP of 2.75, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-chloro-1,3-benzothiazol-6-ol is sourced from PubChem (CID 70388805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).