C9H8ClNO3S — CID 70388805
acetic acid;2-chloro-1,3-benzothiazol-6-ol (PubChem CID 70388805) has the molecular formula C9H8ClNO3S and a molecular weight of 245.69 g/mol. Its IUPAC name is acetic acid;2-chloro-1,3-benzothiazol-6-ol.
| Compound Name | acetic acid;2-chloro-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 70388805 |
| Molecular Formula | C9H8ClNO3S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | acetic acid;2-chloro-1,3-benzothiazol-6-ol |
| SMILES | CC(=O)O.Oc1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C7H4ClNOS.C2H4O2/c8-7-9-5-2-1-4(10)3-6(5)11-7;1-2(3)4/h1-3,10H;1H3,(H,3,4) |
| InChIKey | HDPFVMHPYKDMJW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |