C10H8ClNO2S2 — CID 87233746
2-[(2-chloro-1,3-benzothiazol-6-yl)oxy]propanethioic S-acid (PubChem CID 87233746) has the molecular formula C10H8ClNO2S2 and a molecular weight of 273.77 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-benzothiazol-6-yl)oxy]propanethioic S-acid.
| Compound Name | 2-[(2-chloro-1,3-benzothiazol-6-yl)oxy]propanethioic S-acid |
|---|---|
| PubChem CID | 87233746 |
| Molecular Formula | C10H8ClNO2S2 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 2-[(2-chloro-1,3-benzothiazol-6-yl)oxy]propanethioic S-acid |
| SMILES | CC(Oc1ccc2nc(Cl)sc2c1)C(=O)S |
| InChI | InChI=1S/C10H8ClNO2S2/c1-5(9(13)15)14-6-2-3-7-8(4-6)16-10(11)12-7/h2-5H,1H3,(H,13,15) |
| InChIKey | ZZIGSSHMSVBLDC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|