2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid

C14H17NO3S — CID 82189959

IUPAC2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid
SMILESCCCCc1nc2ccc(OC(C)C(=O)O)cc2s1
InChIInChI=1S/C14H17NO3S/c1-3-4-5-13-15-11-7-6-10(8-12(11)19-13)18-9(2)14(16)17/h6-9H,3-5H2,1-2H3,(H,16,17)
InChIKeyUSCKFXMQDFUAMW-UHFFFAOYSA-N
MW279.36 g/mol
LogP3.49
Rot. Bonds6

About 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid

2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid (PubChem CID 82189959) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid.

Molecular Properties

Compound Name2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid
PubChem CID82189959
Molecular FormulaC14H17NO3S
Molecular Weight279.36 g/mol
Exact Mass279.09
IUPAC Name2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid
SMILESCCCCc1nc2ccc(OC(C)C(=O)O)cc2s1
InChIInChI=1S/C14H17NO3S/c1-3-4-5-13-15-11-7-6-10(8-12(11)19-13)18-9(2)14(16)17/h6-9H,3-5H2,1-2H3,(H,16,17)
InChIKeyUSCKFXMQDFUAMW-UHFFFAOYSA-N
XLogP3.49
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.36
LogP ≤ 53.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid?
The IUPAC name of 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid (CID 82189959) is 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid.
What is the SMILES notation for 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid?
The canonical SMILES for 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid is CCCCc1nc2ccc(OC(C)C(=O)O)cc2s1.
What is the InChIKey of 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid?
The InChIKey is USCKFXMQDFUAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c1-3-4-5-13-15-11-7-6-10(8-12(11)19-13)18-9(2)14(16)17/h6-9H,3-5H2,1-2H3,(H,16,17).
What are the key properties of 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid?
2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid has a molecular weight of 279.36 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propanoic acid is sourced from PubChem (CID 82189959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).