2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid

C15H19NO3S — CID 82189961

IUPAC2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid
SMILESCCCCc1nc2ccc(OC(C)(C)C(=O)O)cc2s1
InChIInChI=1S/C15H19NO3S/c1-4-5-6-13-16-11-8-7-10(9-12(11)20-13)19-15(2,3)14(17)18/h7-9H,4-6H2,1-3H3,(H,17,18)
InChIKeyWYCSAJGUSPDHLG-UHFFFAOYSA-N
MW293.39 g/mol
LogP3.88
Rot. Bonds6

About 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid

2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid (PubChem CID 82189961) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid.

Molecular Properties

Compound Name2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid
PubChem CID82189961
Molecular FormulaC15H19NO3S
Molecular Weight293.39 g/mol
Exact Mass293.11
IUPAC Name2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid
SMILESCCCCc1nc2ccc(OC(C)(C)C(=O)O)cc2s1
InChIInChI=1S/C15H19NO3S/c1-4-5-6-13-16-11-8-7-10(9-12(11)20-13)19-15(2,3)14(17)18/h7-9H,4-6H2,1-3H3,(H,17,18)
InChIKeyWYCSAJGUSPDHLG-UHFFFAOYSA-N
XLogP3.88
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.39
LogP ≤ 53.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid?
The IUPAC name of 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid (CID 82189961) is 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid.
What is the SMILES notation for 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid?
The canonical SMILES for 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid is CCCCc1nc2ccc(OC(C)(C)C(=O)O)cc2s1.
What is the InChIKey of 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid?
The InChIKey is WYCSAJGUSPDHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3S/c1-4-5-6-13-16-11-8-7-10(9-12(11)20-13)19-15(2,3)14(17)18/h7-9H,4-6H2,1-3H3,(H,17,18).
What are the key properties of 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid?
2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid has a molecular weight of 293.39 g/mol, XLogP of 3.88, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-butyl-1,3-benzothiazol-6-yl)oxy]-2-methylpropanoic acid is sourced from PubChem (CID 82189961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).